Introduction:Basic information about CAS 893724-67-9|2-Chloro-3-(2-chloroethyl)-7,8-dimethylquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-3-(2-chloroethyl)-7,8-dimethylquinoline |
|---|
| CAS Number | 893724-67-9 | Molecular Weight | 254.15500 |
|---|
| Density | 1.237g/cm3 | Boiling Point | 383.798ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13Cl2N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 217.926ºC |
|---|
Names
| Name | 2-Chloro-3-(2-chloroethyl)-7,8-dimethylquinoline |
|---|
Chemical & Physical Properties
| Density | 1.237g/cm3 |
|---|
| Boiling Point | 383.798ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13Cl2N |
|---|
| Molecular Weight | 254.15500 |
|---|
| Flash Point | 217.926ºC |
|---|
| Exact Mass | 253.04300 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 4.28630 |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | PTEZZCNKIIJTDL-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc2cc(CCCl)c(Cl)nc2c1C |
|---|