Introduction:Basic information about CAS 948294-61-9|2-Chloro-3-(3-chloropropyl)-6,8-dimethylquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-3-(3-chloropropyl)-6,8-dimethylquinoline |
|---|
| CAS Number | 948294-61-9 | Molecular Weight | 268.18200 |
|---|
| Density | 1.208g/cm3 | Boiling Point | 393.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15Cl2N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 224ºC |
|---|
Names
| Name | 2-Chloro-3-(3-chloropropyl)-6,8-dimethylquinoline |
|---|
Chemical & Physical Properties
| Density | 1.208g/cm3 |
|---|
| Boiling Point | 393.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15Cl2N |
|---|
| Molecular Weight | 268.18200 |
|---|
| Flash Point | 224ºC |
|---|
| Exact Mass | 267.05800 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 4.67640 |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | HTPDMHBSJPICRM-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c2nc(Cl)c(CCCCl)cc2c1 |
|---|