Introduction:Basic information about CAS 948294-63-1|2-Chloro-3-(3-chloropropyl)-6-ethoxyquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-3-(3-chloropropyl)-6-ethoxyquinoline |
|---|
| CAS Number | 948294-63-1 | Molecular Weight | 284.18100 |
|---|
| Density | 1.235g/cm3 | Boiling Point | 410.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15Cl2NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 201.9ºC |
|---|
Names
| Name | 2-Chloro-3-(3-chloropropyl)-6-ethoxyquinoline |
|---|
Chemical & Physical Properties
| Density | 1.235g/cm3 |
|---|
| Boiling Point | 410.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15Cl2NO |
|---|
| Molecular Weight | 284.18100 |
|---|
| Flash Point | 201.9ºC |
|---|
| Exact Mass | 283.05300 |
|---|
| PSA | 22.12000 |
|---|
| LogP | 4.45830 |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | HPJPNDYPWRSFAK-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccc2nc(Cl)c(CCCCl)cc2c1 |
|---|