Introduction：Basic information about CAS 18861-57-9|ETHYL ALPHA-CYANO-4-FLUOROCINNAMATE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ETHYL ALPHA-CYANO-4-FLUOROCINNAMATE |
|---|
| CAS Number | 18861-57-9 | Molecular Weight | 219.21200 |
|---|
| Density | 1.212g/cm3 | Boiling Point | 330.7ºC at 760mmHg |
|---|
| Molecular Formula | C12H10FNO2 | Melting Point | 96-100ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 153.8ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | Ethyl α-cyano-4-fluorocinnamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.212g/cm3 |
|---|
| Boiling Point | 330.7ºC at 760mmHg |
|---|
| Melting Point | 96-100ºC(lit.) |
|---|
| Molecular Formula | C12H10FNO2 |
|---|
| Molecular Weight | 219.21200 |
|---|
| Flash Point | 153.8ºC |
|---|
| Exact Mass | 219.07000 |
|---|
| PSA | 50.09000 |
|---|
| LogP | 2.29578 |
|---|
| Vapour Pressure | 0.000164mmHg at 25°C |
|---|
| Index of Refraction | 1.549 |
|---|
| InChIKey | OSTPLWBGNXWIBG-JXMROGBWSA-N |
|---|
| SMILES | CCOC(=O)C(C#N)=Cc1ccc(F)cc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | 22 |
|---|
| Safety Phrases | 36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 2-Cyano-3-(4-fluorophenyl)propenoic acid ethyl ester |
| MFCD00176412 |
| ethyl 2-cyano-3-(4-fluoro)phenyl-2-propenoate |
| 4-Fluorobenzylidenecyanoacetic acid ethyl ester |
| ethyl 2-cyano-3-(4-fluorophenyl)prop-2-enecarboxylate |
| 2-cyano-3-(4-fluorophenyl)-acrylic acid ethyl ester |
| EINECS 242-633-7 |
| ethyl 2-cyano-3-(4-fluorophenyl)acrylate |
| ethyl 4-fluorobenzalcyanoacetate |
