Introduction：Basic information about CAS 34576-83-5|3-chloro-6-fluorobenzothiophene-2-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-chloro-6-fluorobenzothiophene-2-carbonyl chloride |
|---|
| CAS Number | 34576-83-5 | Molecular Weight | 249.08900 |
|---|
| Density | 1.6g/cm3 | Boiling Point | 345.7ºC at 760mmHg |
|---|
| Molecular Formula | C9H3Cl2FOS | Melting Point | 108-112ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 162.9ºC |
|---|
Names
| Name | 3-Chloro-6-fluoro-1-benzothiophene-2-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6g/cm3 |
|---|
| Boiling Point | 345.7ºC at 760mmHg |
|---|
| Melting Point | 108-112ºC(lit.) |
|---|
| Molecular Formula | C9H3Cl2FOS |
|---|
| Molecular Weight | 249.08900 |
|---|
| Flash Point | 162.9ºC |
|---|
| Exact Mass | 247.92700 |
|---|
| PSA | 45.31000 |
|---|
| LogP | 4.07280 |
|---|
| Index of Refraction | 1.662 |
|---|
| InChIKey | IUDFNLIAWHEYEZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1sc2cc(F)ccc2c1Cl |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | 34 |
|---|
| Safety Phrases | 22-24/25 |
|---|
| RIDADR | UN3261 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-chloro-6-fluoro-benzo[b]thiophene-2-carbonyl chloride |
| 2-Chlorcarbonyl-3-chlor-6-fluorbenzo<b>thiophen |
| 3-Chloro-6-fluorobenzo[b]thiophene-2-carbonyl chloride |
| 3-Chloro-6-fluorobenzthien-2-carboxylic acid chloride |
| 3-Chlor-6-fluor-benzo-<b>thiophen-2-carbonsaeurechlorid |
| 3-chloro-6-fluorobenzothiophene-2-carbonyl chloride |
