Introduction：Basic information about CAS 189338-32-7|2,6-Dichloro-4-(trifluoromethyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Dichloro-4-(trifluoromethyl)benzoic acid |
|---|
| CAS Number | 189338-32-7 | Molecular Weight | 259.00900 |
|---|
| Density | / | Boiling Point | 266.242ºC at 760 mmHg |
|---|
| Molecular Formula | C8H3Cl2F3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 114.819ºC |
|---|
Names
| Name | 2,6-Dichloro-4-(trifluoromethyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 266.242ºC at 760 mmHg |
|---|
| Molecular Formula | C8H3Cl2F3O2 |
|---|
| Molecular Weight | 259.00900 |
|---|
| Flash Point | 114.819ºC |
|---|
| Exact Mass | 257.94600 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.71040 |
|---|
| Vapour Pressure | 0.004mmHg at 25°C |
|---|
| Index of Refraction | 1.514 |
|---|
| InChIKey | YCKXVVIPFMCOPF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1c(Cl)cc(C(F)(F)F)cc1Cl |
|---|
Synonyms
| 4-Carboxy-3,5-dichlorobenzotrifluoride |
| 2,6-dichloro-4-trifluoromethylbenzoic acid |
