Introduction:Basic information about CAS 97272-02-1|5-Phenylthiophene-2-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Phenylthiophene-2-sulfonyl chloride |
|---|
| CAS Number | 97272-02-1 | Molecular Weight | 258.74400 |
|---|
| Density | 1.43g/cm3 | Boiling Point | 397.4ºC at 760mmHg |
|---|
| Molecular Formula | C10H7ClO2S2 | Melting Point | 85-87ºC |
|---|
| MSDS | USA | Flash Point | 194.1ºC |
|---|
Names
| Name | 5-Phenylthiophene-2-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Boiling Point | 397.4ºC at 760mmHg |
|---|
| Melting Point | 85-87ºC |
|---|
| Molecular Formula | C10H7ClO2S2 |
|---|
| Molecular Weight | 258.74400 |
|---|
| Flash Point | 194.1ºC |
|---|
| Exact Mass | 257.95800 |
|---|
| PSA | 70.76000 |
|---|
| LogP | 4.42340 |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | NHRKTBLHJKMFTP-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc(-c2ccccc2)s1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-Phenylthiophene-2-sulphonyl chloride |
| 5-phenyl-thiophene-2-sulfonyl chloride |
| 5-Phenyl-2-thiophenesulfonyl chloride |
| 5-phenyl-2-thiophenesulphonyl chloride |