Introduction:Basic information about CAS 98303-20-9|N-BOC-2-Piperidinecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-BOC-2-Piperidinecarboxylic acid |
|---|
| CAS Number | 98303-20-9 | Molecular Weight | 229.273 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 353.2±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H19NO4 | Melting Point | 130-133ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 167.4±25.9 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | N-BOC-2-Piperidinecarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 353.2±35.0 °C at 760 mmHg |
|---|
| Melting Point | 130-133ºC |
|---|
| Molecular Formula | C11H19NO4 |
|---|
| Molecular Weight | 229.273 |
|---|
| Flash Point | 167.4±25.9 °C |
|---|
| Exact Mass | 229.131409 |
|---|
| PSA | 66.84000 |
|---|
| LogP | 1.13 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.496 |
|---|
| InChIKey | JQAOHGMPAAWWQO-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCCCC1C(=O)O |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,2-Piperidinedicarboxylic acid, 1-(1,1-dimethylethyl) ester, (2R)- |
| 1-(tert-Butoxycarbonyl)piperidine-2-carboxylic acid |
| (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid |
| 1,2-Piperidinedicarboxylic acid, 1-(1,1-dimethylethyl) ester |
| rac 1-Boc-piperidine-2-carboxylic acid |
| MFCD01862877 |
| 1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid |
| N-Boc-2-Piperidinecarboxylicacid |