Introduction：Basic information about CAS 18869-30-2|trans-4,4'-Dibromostilbene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | trans-4,4'-Dibromostilbene |
|---|
| CAS Number | 18869-30-2 | Molecular Weight | 338.037 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 392.9±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H10Br2 | Melting Point | 212ºC |
|---|
| MSDS | USA | Flash Point | 223.9±18.5 °C |
|---|
| Symbol |
GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 4,4'-dibromo-trans-stilbene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 392.9±11.0 °C at 760 mmHg |
|---|
| Melting Point | 212ºC |
|---|
| Molecular Formula | C14H10Br2 |
|---|
| Molecular Weight | 338.037 |
|---|
| Flash Point | 223.9±18.5 °C |
|---|
| Exact Mass | 335.914917 |
|---|
| LogP | 6.61 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.698 |
|---|
| InChIKey | JEHMPNUQSJNJDL-OWOJBTEDSA-N |
|---|
| SMILES | Brc1ccc(C=Cc2ccc(Br)cc2)cc1 |
|---|
Safety Information
| Symbol |
GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H315-H318-H413 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | Xn;N |
|---|
| Risk Phrases | R22;R38;R41;R51 |
|---|
| Safety Phrases | S53-S26-S39-S61 |
|---|
| RIDADR | UN 3077 |
|---|
| HS Code | 2903999090 |
|---|
Customs
| HS Code | 2903999090 |
|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Benzene,1,1'-(1E)-1,2-ethenediylbis[4-broMo |
| (E)-1,2-bis(p-phenylbromo)ethene |
| 4,4'-dibromo-(E)-1,2-diphenylethene |
| (E)-1,2-bis(p-bromophenyl)ethene |
| 1-BROMO-4-[2-(4-BROMOPHENYL)VINYL]BENZENE |
| (E)-1,2-Bis(4-bromophenyl)ethene |
| (E)-1,2-bis(4-bromophenyl)ethane |
| 1,2-Bis(4-bromophenyl)ethene |
| 4,4'-Dibromostilbene |
| 1,1'-(E)-Ethene-1,2-diylbis(4-bromobenzene) |
| trans-4,4'-Dibromostilbene |
| (E)-1-bromo-4-(4-bromostyryl)benzene |
| 1,1'-[(E)-1,2-Ethenediyl]bis(4-bromobenzene) |
| 4,4'-DIBROMO-STILBENE |
| 4,4'-Dibromo-trans-stilbene |
| Benzene, 1,1'-[(E)-1,2-ethenediyl]bis[4-bromo- |
