Introduction:Basic information about CAS 78603-97-1|(S)-(-)-2-ACETOXYPROPIONYLCHLORIDE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-(-)-2-ACETOXYPROPIONYLCHLORIDE |
|---|
| CAS Number | 78603-97-1 | Molecular Weight | 269.38100 |
|---|
| Density | 1.059 g/cm3 | Boiling Point | 436.6ºC at 760 mmHg |
|---|
| Molecular Formula | C18H23NO | Melting Point | 132-136ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 217.8ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | (2S)-2-amino-4-methyl-1,1-diphenylpentan-1-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.059 g/cm3 |
|---|
| Boiling Point | 436.6ºC at 760 mmHg |
|---|
| Melting Point | 132-136ºC(lit.) |
|---|
| Molecular Formula | C18H23NO |
|---|
| Molecular Weight | 269.38100 |
|---|
| Flash Point | 217.8ºC |
|---|
| Exact Mass | 269.17800 |
|---|
| PSA | 46.25000 |
|---|
| LogP | 3.99620 |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | XECSMDWXBMBRDE-KRWDZBQOSA-N |
|---|
| SMILES | CC(C)CC(N)C(O)(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 2 |
|---|
Synonyms
| Benzenemethanol,a-[(1S)-1-amino-3-methylbutyl]-a-phenyl |
| MFCD03093529 |
| (S)-(-)-2-amino-4-methyl-1,1-diphenylpentanol |
| (S)-2-amino-4-methyl-1,1-diphenylpentan-1-ol |
| (S)-(-)-2-Amino-4-methyl-1,1-diphenyl-1-pentanol |
| (S)-2-Amino-1,1-diphenyl-4-methyl-pentanol |
| (S)-diphenyl leucinol |
| (S)-2-amino-1,1-diphenyl-4-methylpentan-1-ol |