Introduction：Basic information about CAS 186692-44-4|SELICICLIB, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | SELICICLIB |
|---|
| CAS Number | 186692-44-4 | Molecular Weight | 354.44900 |
|---|
| Density | 1.25 | Boiling Point | 577.5ºC at 760 mmHg |
|---|
| Molecular Formula | C19H26N6O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 303.1ºC |
|---|
Names
| Name | (2S)-2-{[6-(Benzylamino)-9-isopropyl-9H-purin-2-yl]amino}-1-butan ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.25 |
|---|
| Boiling Point | 577.5ºC at 760 mmHg |
|---|
| Molecular Formula | C19H26N6O |
|---|
| Molecular Weight | 354.44900 |
|---|
| Flash Point | 303.1ºC |
|---|
| Exact Mass | 354.21700 |
|---|
| PSA | 91.12000 |
|---|
| LogP | 2.69700 |
|---|
| Vapour Pressure | 3.52E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | BTIHMVBBUGXLCJ-UHFFFAOYSA-N |
|---|
| SMILES | CCC(CO)Nc1nc(NCc2ccccc2)c2ncn(C(C)C)c2n1 |
|---|
Synonyms
| 5-formylpentyl benzoate |
| 2-(1-ethyl-2-hydroxyethylamino)-N6-(benzyl)-9-isopropyladenine |
| Hexanal,6-(benzoyloxy) |
| 2-[[9-(1-methylethyl)-6-[(phenylmethyl)amino]-9H-purin-2-yl]amino]-1-butanol |
| 6-(benzylamino)-2-[(1-hydroxymethylpropyl)amino]-9-isopropylpurine |
| (+/-)-Roscovitine |
| RS-roscovitine |
| 6-(benzoyloxy)hexanal |
