Introduction：Basic information about CAS 478963-35-8|6-Amino-1-isopropyl-4-(4-isopropylphenyl)-2(1H)-quinazolinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Amino-1-isopropyl-4-(4-isopropylphenyl)-2(1H)-quinazolinone |
|---|
| CAS Number | 478963-35-8 | Molecular Weight | 321.41600 |
|---|
| Density | 1.16g/cm3 | Boiling Point | 495.5ºC at 760 mmHg |
|---|
| Molecular Formula | C20H23N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 253.5ºC |
|---|
Names
| Name | 6-Amino-1-isopropyl-4-(4-isopropylphenyl)-2(1H)-quinazolinone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.16g/cm3 |
|---|
| Boiling Point | 495.5ºC at 760 mmHg |
|---|
| Molecular Formula | C20H23N3O |
|---|
| Molecular Weight | 321.41600 |
|---|
| Flash Point | 253.5ºC |
|---|
| Exact Mass | 321.18400 |
|---|
| PSA | 60.91000 |
|---|
| LogP | 4.93120 |
|---|
| Index of Refraction | 1.615 |
|---|
| InChIKey | YCYCWFAGGTXGEP-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)c1ccc(-c2nc(=O)n(C(C)C)c3ccc(N)cc23)cc1 |
|---|
Synonyms
| 6-Amino-1-indancarbonsaeure |
| 1H-Indene-1-carboxylic acid,6-amino-2,3-dihydro |
| 6-amino-1-isopropyl-4-(4-isopropylphenyl)-1H-quinazolin-2-one |
