Introduction：Basic information about CAS 792911-66-1|2-Chloro-N-[(1-hydroxycycloheptyl)methyl]-5-[1-(2-hydroxyethyl)-5 -methyl-1H-pyrazol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-N-[(1-hydroxycycloheptyl)methyl]-5-[1-(2-hydroxyethyl)-5 -methyl-1H-pyrazol-3-yl]benzamide |
|---|
| CAS Number | 792911-66-1 | Molecular Weight | 405.91800 |
|---|
| Density | 1.306g/cm3 | Boiling Point | 594.665ºC at 760 mmHg |
|---|
| Molecular Formula | C21H28ClN3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 313.442ºC |
|---|
Names
| Name | 2-Chloro-N-[(1-hydroxycycloheptyl)methyl]-5-[1-(2-hydroxyethyl)-5 -methyl-1H-pyrazol-3-yl]benzamide |
|---|
Chemical & Physical Properties
| Density | 1.306g/cm3 |
|---|
| Boiling Point | 594.665ºC at 760 mmHg |
|---|
| Molecular Formula | C21H28ClN3O3 |
|---|
| Molecular Weight | 405.91800 |
|---|
| Flash Point | 313.442ºC |
|---|
| Exact Mass | 405.18200 |
|---|
| PSA | 90.87000 |
|---|
| LogP | 3.89410 |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | LIXPWXKRADRKMY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(-c2ccc(Cl)c(C(=O)NCC3(O)CCCCCC3)c2)nn1CCO |
|---|
