Introduction：Basic information about CAS 490-63-1|2-Formyl-4,5-dimethoxybenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Formyl-4,5-dimethoxybenzoic acid |
|---|
| CAS Number | 490-63-1 | Molecular Weight | 210.18300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H10O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-Formyl-4,5-dimethoxybenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H10O5 |
|---|
| Molecular Weight | 210.18300 |
|---|
| Exact Mass | 210.05300 |
|---|
| PSA | 72.83000 |
|---|
| LogP | 1.21450 |
|---|
| InChIKey | CXANNUKKXKKTKG-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C=O)c(C(=O)O)cc1OC |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| m-opianic acid |
| 2-Formyl-4,5-dimethoxy-benzoesaeure |
| 4,5-dimethoxy-2-formylbenzoic acid |
| 2-formyl-4.5-dimethoxy-benzoic acid |
| Benzoic acid,2-formyl-4,5-dimethoxy |
| 6-formyl-3,4-dimethoxybenzoic acid |
