Introduction：Basic information about CAS 71171-94-3|Oxazole, 2-(4-fluorophenyl)-4,5-dihydro-4,4-dimethyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Oxazole, 2-(4-fluorophenyl)-4,5-dihydro-4,4-dimethyl- |
|---|
| CAS Number | 71171-94-3 | Molecular Weight | 193.21700 |
|---|
| Density | 1.13g/cm3 | Boiling Point | 258ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12FNO | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-(4-fluorophenyl)-4,4-dimethyl-5H-1,3-oxazole |
|---|
Chemical & Physical Properties
| Density | 1.13g/cm3 |
|---|
| Boiling Point | 258ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12FNO |
|---|
| Molecular Weight | 193.21700 |
|---|
| Exact Mass | 193.09000 |
|---|
| PSA | 21.59000 |
|---|
| LogP | 1.81670 |
|---|
| Index of Refraction | 1.529 |
|---|
| InChIKey | GUWPOJDUVLSBQT-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)COC(c2ccc(F)cc2)=N1 |
|---|
