Introduction:Basic information about CAS 71119-12-5|Dinazafone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dinazafone |
|---|
| CAS Number | 71119-12-5 | Molecular Weight | 356.84600 |
|---|
| Density | 1.186g/cm3 | Boiling Point | 524.6ºC at 760 mmHg |
|---|
| Molecular Formula | C20H21ClN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 271.1ºC |
|---|
Names
| Name | N-(2-Benzoyl-4-chlorophenyl)-N-methyl-N2-(2-methyl-2-propen-1-yl)glycinamide |
|---|
Chemical & Physical Properties
| Density | 1.186g/cm3 |
|---|
| Boiling Point | 524.6ºC at 760 mmHg |
|---|
| Molecular Formula | C20H21ClN2O2 |
|---|
| Molecular Weight | 356.84600 |
|---|
| Flash Point | 271.1ºC |
|---|
| Exact Mass | 356.12900 |
|---|
| PSA | 49.41000 |
|---|
| LogP | 4.09040 |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | QJPROCZAUFTKEV-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)CNCC(=O)N(C)c1ccc(Cl)cc1C(=O)c1ccccc1 |
|---|