Introduction：Basic information about CAS 78370-13-5|Emopamil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Emopamil |
|---|
| CAS Number | 78370-13-5 | Molecular Weight | 334.498 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 485.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H30N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 201.1±18.0 °C |
|---|
Names
| Name | 5-[methyl(2-phenylethyl)amino]-2-phenyl-2-propan-2-ylpentanenitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 485.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H30N2 |
|---|
| Molecular Weight | 334.498 |
|---|
| Flash Point | 201.1±18.0 °C |
|---|
| Exact Mass | 334.240906 |
|---|
| PSA | 27.03000 |
|---|
| LogP | 4.43 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.543 |
|---|
| InChIKey | DWAWDSVKAUWFHC-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C(C#N)(CCCN(C)CCc1ccccc1)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-Isopropyl-5-[methyl(2-phenylethyl)amino]-2-phenylpentanenitrile |
| Benzeneacetonitrile, α-(1-methylethyl)-α-[3-[methyl(2-phenylethyl)amino]propyl]- |
| Emopamil |
| Emopamilo [Spanish] |
| 2-isopropyl-5-[methyl(2-phenylethyl)amino]-2-phenylpentanonitril |
| 2-Isopropyl-5-(methylphenethylamino)-2-phenylvaleronitrile |
| emopamil,(+-)-isomer |
| Emopamilum [Latin] |
| C23H30N2 |
| Levemopamil |
| Emopamil [INN] |
| 5-[methyl(2-phenylethyl)amino]-2-phenyl-2-(propan-2-yl)pentanenitrile |
