Introduction：Basic information about CAS 18857-59-5|Nifurmazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nifurmazole |
|---|
| CAS Number | 18857-59-5 | Molecular Weight | 294.22000 |
|---|
| Density | 1.61g/cm3 | Boiling Point | 474.2ºC at 760mmHg |
|---|
| Molecular Formula | C11H10N4O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 240.6ºC |
|---|
Names
| Name | 3-(hydroxymethyl)-1-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylideneamino]imidazolidine-2,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.61g/cm3 |
|---|
| Boiling Point | 474.2ºC at 760mmHg |
|---|
| Molecular Formula | C11H10N4O6 |
|---|
| Molecular Weight | 294.22000 |
|---|
| Flash Point | 240.6ºC |
|---|
| Exact Mass | 294.06000 |
|---|
| PSA | 132.17000 |
|---|
| LogP | 0.79980 |
|---|
| Vapour Pressure | 8.48E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.675 |
|---|
| InChIKey | IKQHXERIXMQWQK-LYTCUFGASA-N |
|---|
| SMILES | O=C1CN(N=CC=Cc2ccc([N+](=O)[O-])o2)C(=O)N1CO |
|---|
Synonyms
| Nifurmazole [INN:DCF] |
| 3-hydroxymethyl-1-[3-(5-nitro-furan-2-yl)-allylideneamino]-imidazolidine-2,4-dione |
| Nifurmazolum [INN-Latin] |
| Nifurmazolo [DCIT] |
| Nifurmazole |
| 3-Hydroxymethyl-1-((3-(5-nitro-2-furyl)allylidene)amino)hydantoin |
| Nifurmazol [INN-Spanish] |
