Introduction：Basic information about CAS 56739-21-0|Nitraquazone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nitraquazone |
|---|
| CAS Number | 56739-21-0 | Molecular Weight | 311.29200 |
|---|
| Density | 1.383g/cm3 | Boiling Point | 494ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 252.6ºC |
|---|
Names
| Name | 3-Ethyl-1-(3-nitrophenyl)-2,4(1H,3H)-quinazolinedione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.383g/cm3 |
|---|
| Boiling Point | 494ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13N3O4 |
|---|
| Molecular Weight | 311.29200 |
|---|
| Flash Point | 252.6ºC |
|---|
| Exact Mass | 311.09100 |
|---|
| PSA | 89.82000 |
|---|
| LogP | 2.60370 |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | GNWCRBFQZDJFTI-UHFFFAOYSA-N |
|---|
| SMILES | CCn1c(=O)c2ccccc2n(-c2cccc([N+](=O)[O-])c2)c1=O |
|---|
Synonyms
| nitraquazone |
| 3-ethyl-1-(3-nitro-phenyl)-1H-quinazoline-2,4-dione |
| 1-(m-nitrophenyl)-3-ethylquinazoline-2,4(1H,3H)-dione |
| 1-(m-nitrophenyl)-3-ethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione |
| 3-ethyl-1-(3-nitro-phenyl)-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
| Pyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione,3-ethyl-1-(3-nitrophenyl) |
| 1-(m-nitrophenyl)-3-ethylquinazoline-2,4 (1H |
