Introduction：Basic information about CAS 6363-02-6|Nitramisole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nitramisole |
|---|
| CAS Number | 6363-02-6 | Molecular Weight | 249.28900 |
|---|
| Density | 1.56g/cm3 | Boiling Point | 410.8ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11N3O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 202.2ºC |
|---|
Names
| Name | 6-(3-Nitrophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.56g/cm3 |
|---|
| Boiling Point | 410.8ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11N3O2S |
|---|
| Molecular Weight | 249.28900 |
|---|
| Flash Point | 202.2ºC |
|---|
| Exact Mass | 249.05700 |
|---|
| PSA | 86.72000 |
|---|
| LogP | 1.95100 |
|---|
| Index of Refraction | 1.766 |
|---|
| InChIKey | RFAYUIIWPKWNKY-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cccc(C2CN3CCSC3=N2)c1 |
|---|
Synonyms
| Nitramisole [INN] |
| Nitramisolum |
| Imidazo(2,1-b)thiazole,2,3,5,6-tetrahydro-6-(3-nitrophenyl) |
| Nitramisole |
| (+-)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo(2,1-b)thiazol |
| Nitramisol |
