Introduction：Basic information about CAS 108413-50-9|5-[3-(trifluoromethyl)phenyl]-3H-1,3,4-oxadiazole-2-thione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-[3-(trifluoromethyl)phenyl]-3H-1,3,4-oxadiazole-2-thione |
|---|
| CAS Number | 108413-50-9 | Molecular Weight | 246.20900 |
|---|
| Density | 1.447g/cm3 | Boiling Point | 311.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H5F3N2OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 142.1ºC |
|---|
Names
| Name | 5-[3-(trifluoromethyl)phenyl]-3H-1,3,4-oxadiazole-2-thione |
|---|
Chemical & Physical Properties
| Density | 1.447g/cm3 |
|---|
| Boiling Point | 311.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H5F3N2OS |
|---|
| Molecular Weight | 246.20900 |
|---|
| Flash Point | 142.1ºC |
|---|
| Exact Mass | 246.00700 |
|---|
| PSA | 77.72000 |
|---|
| LogP | 3.04410 |
|---|
| Vapour Pressure | 0.00103mmHg at 25°C |
|---|
| Index of Refraction | 1.529 |
|---|
| InChIKey | NOUYMYSPIXNRAD-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1cccc(-c2n[nH]c(=S)o2)c1 |
|---|
