Introduction：Basic information about CAS 6471-51-8|N-(4-chloro-2-methylphenyl)-4-[(4-chloro-2-methylphenyl)azo]-3-hydroxynaphthalene-2-ca, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(4-chloro-2-methylphenyl)-4-[(4-chloro-2-methylphenyl)azo]-3-hydroxynaphthalene-2-carboxamide |
|---|
| CAS Number | 6471-51-8 | Molecular Weight | 464.34300 |
|---|
| Density | 1.341g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C25H19Cl2N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (4Z)-N-(4-chloro-2-methylphenyl)-4-[(4-chloro-2-methylphenyl)hydrazinylidene]-3-oxonaphthalene-2-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.341g/cm3 |
|---|
| Molecular Formula | C25H19Cl2N3O2 |
|---|
| Molecular Weight | 464.34300 |
|---|
| Exact Mass | 463.08500 |
|---|
| PSA | 70.56000 |
|---|
| LogP | 6.17720 |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | KWORKYDIARWARF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Cl)ccc1N=Nc1c(O)c(C(=O)Nc2ccc(Cl)cc2C)cc2ccccc12 |
|---|
