Introduction：Basic information about CAS 5855-57-2|4-PHENYL-QUINOLIN-2-OL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-PHENYL-QUINOLIN-2-OL |
|---|
| CAS Number | 5855-57-2 | Molecular Weight | 221.25400 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 425.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H11NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 254.8ºC |
|---|
Names
| Name | 4-phenyl-1H-quinolin-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 425.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H11NO |
|---|
| Molecular Weight | 221.25400 |
|---|
| Flash Point | 254.8ºC |
|---|
| Exact Mass | 221.08400 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 3.60740 |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | QKQNVNSIRYIHDD-UHFFFAOYSA-N |
|---|
| SMILES | O=c1cc(-c2ccccc2)c2ccccc2[nH]1 |
|---|
Synonyms
| 1,2-dihydro-2-oxo-4-phenyl-quinoline |
| 4-phenyl-2-quinolinone |
| 4-phenyl-quinolin-2-ol |
| 4-phenyl-2-quinoline |
| 3-Deoxyviridicatin |
| 4-phenylquinoline-2(1H)-one |
| 4-phenyl-2(1H)-quinolinone |
| 4-phenylcarbostyril |
