Introduction：Basic information about CAS 77811-44-0|4-Bromo-2-methyl-6-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Bromo-2-methyl-6-nitroaniline |
|---|
| CAS Number | 77811-44-0 | Molecular Weight | 231.047 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 326.8±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H7BrN2O2 | Melting Point | 143-147 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 151.4±26.5 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-Bromo-2-methyl-6-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 326.8±37.0 °C at 760 mmHg |
|---|
| Melting Point | 143-147 °C |
|---|
| Molecular Formula | C7H7BrN2O2 |
|---|
| Molecular Weight | 231.047 |
|---|
| Flash Point | 151.4±26.5 °C |
|---|
| Exact Mass | 229.969086 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 3.21 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.649 |
|---|
| InChIKey | ZXFVKFUXKFPUQJ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Br)cc([N+](=O)[O-])c1N |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H312-H315-H319-H332-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S26-S36/37 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2921430090 |
|---|
Customs
| HS Code | 2921430090 |
|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| MFCD00052919 |
| 4-bromo-2-methyl-6-nitro-aniline |
| 2-Amino-5-bromo-3-nitrotoluene,2-Amino-5-bromo-3-methylnitrobenzene,4-Bromo-6-nitro-o-toulidine |
| BenzenaMine,4-broMo-2-Methyl-6-nitro |
| 4-bromo-6-methyl-2-nitroaniline |
| 4-broMo-2-Methyl-6-nitroanilin |
| 4-Bromo-6-nitro-o-toluidine 2-Amino-5-bromo-3-nitrotoluene |
| Benzenamine, 4-bromo-2-methyl-6-nitro- |
| o-Nitro-p-brom-o-toluidin |
| 4-BROMO-6-NITRO-O-TOLUIDINE |
| 2-Nitro-4-bromo-6-methylaniline |
| 5-Brom-3-nitro-2-amino-toluol |
| 4-Brom-2-methyl-6-nitro-anilin |
| 4-BROMO-2-METHYL-6-NITRO-PHENYLAMINE |
| 4-Bromo-2-methyl-6-nitroaniline |
| 4-Bromo-2-methyl-6-nitrobenzenamine |
