Introduction:Basic information about CAS 71868-10-5|2-Methyl-4'-(methylthio)-2-morpholinopropiophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-4'-(methylthio)-2-morpholinopropiophenone |
|---|
| CAS Number | 71868-10-5 | Molecular Weight | 279.398 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 420.1±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H21NO2S | Melting Point | 74-76 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 207.9±27.3 °C |
|---|
| Symbol | GHS07, GHS08, GHS09 | Signal Word | Danger |
|---|
Names
| Name | 2-Methyl-4-(Methylthio)-2-Morpholinopropiophenone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 420.1±40.0 °C at 760 mmHg |
|---|
| Melting Point | 74-76 °C(lit.) |
|---|
| Molecular Formula | C15H21NO2S |
|---|
| Molecular Weight | 279.398 |
|---|
| Flash Point | 207.9±27.3 °C |
|---|
| Exact Mass | 279.129303 |
|---|
| PSA | 54.84000 |
|---|
| LogP | 3.00 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | LWRBVKNFOYUCNP-UHFFFAOYSA-N |
|---|
| SMILES | CSc1ccc(C(=O)C(C)(C)N2CCOCC2)cc1 |
|---|
Safety Information
| Symbol | GHS07, GHS08, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H360-H411 |
|---|
| Precautionary Statements | P201-P280-P301 + P312 + P330-P308 + P313 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful |
|---|
| Risk Phrases | R22;R51/53 |
|---|
| Safety Phrases | S22-S61 |
|---|
| RIDADR | UN 3077 9/PG 3 |
|---|
| WGK Germany | 2 |
|---|
Synonyms
| 2-Methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one |
| 1-Propanone, 2-methyl-1-[4-(methylthio)phenyl]-2-(4-morpholinyl)- |
| MFCD00083014 |
| T6N DOTJ AX1&1&VR DS1 |
| CACCURE 907 |
| 2-Methyl-1-[4-(methylsulfanyl)phenyl]-2-(4-morpholinyl)-1-propanone |
| 2-methyl-1-(4-methylsulfanylphenyl)-2-morpholin-4-ylpropan-1-one |
| 2-methyl-1-[4-(methylthio)phenyl]-2-morpholin-4-ylpropan-1-one |
| 2-methyl-1-[4-(methylsulfanyl)phenyl]-2-(morpholin-4-yl)propan-1-one |
| EINECS 400-600-6 |