Introduction：Basic information about CAS 63562-34-5|bis(2-hydroxyethyl) (6H-dibenz[c,e][1,2]oxaphosphorin-6-ylmethyl)succinate P-oxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(2-hydroxyethyl) (6H-dibenz[c,e][1,2]oxaphosphorin-6-ylmethyl)succinate P-oxide |
|---|
| CAS Number | 63562-34-5 | Molecular Weight | 434.37600 |
|---|
| Density | 1.39 | Boiling Point | 657.6ºC at 760 mmHg |
|---|
| Molecular Formula | C21H23O8P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 351.5ºC |
|---|
Names
| Name | bis(2-hydroxyethyl) 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.39 |
|---|
| Boiling Point | 657.6ºC at 760 mmHg |
|---|
| Molecular Formula | C21H23O8P |
|---|
| Molecular Weight | 434.37600 |
|---|
| Flash Point | 351.5ºC |
|---|
| Exact Mass | 434.11300 |
|---|
| PSA | 129.17000 |
|---|
| LogP | 1.72670 |
|---|
| Index of Refraction | 1.6 |
|---|
| InChIKey | MJOBQUIJUFKMPR-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CC(CP1(=O)Oc2ccccc2-c2ccccc21)C(=O)OCCO)OCCO |
|---|
Synonyms
| EINECS 264-313-6 |
| Butanedioic acid,((6-oxido-6H-dibenz(c,e)(1,2)oxaphosphorin-6-yl)methyl)-,bis(2-hydroxyethyl) ester |
| Bis(2-hydroxyethyl) (6H-dibenz(c,e)(1,2)oxaphosphorin-6-ylmethyl)succinate P-oxide |
