Introduction:Basic information about CAS 6410-41-9|Pigment Red 5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pigment Red 5 |
|---|
| CAS Number | 6410-41-9 | Molecular Weight | 627.10800 |
|---|
| Density | 1.34 | Boiling Point | / |
|---|
| Molecular Formula | C30H31ClN4O7S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (4E)-N-(5-chloro-2,4-dimethoxyphenyl)-4-[[5-(diethylsulfamoyl)-2-methoxyphenyl]hydrazinylidene]-3-oxonaphthalene-2-carboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.34 |
|---|
| Molecular Formula | C30H31ClN4O7S |
|---|
| Molecular Weight | 627.10800 |
|---|
| Exact Mass | 626.16000 |
|---|
| PSA | 147.50000 |
|---|
| LogP | 8.07660 |
|---|
| Index of Refraction | 1.619 |
|---|
| InChIKey | LMULDSDQRQVZMW-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(N=Nc2c(O)c(C(=O)Nc3cc(Cl)c(OC)cc3OC)cc3ccccc23)c1 |
|---|
Synonyms
| UNII-91OZU993LX |
| L728 |
| EINECS 229-107-2 |
| 91OZU993LX |
| 4-(2'-methoxy-5'-sulfonic acid diethylamide-1'-phenylazo)-3-hydroxy-5''-chloro-2'',4''-dimethoxy-2-naphthoic acid anilide |
| 4-(2'-methoxy-5'-sulphodiethylamido-1'-phenylazo)-3-hydroxy-5''-chloro-2'',4''-dimethoxy-2-naphthanilide |
| 2-Naphthalenecarboxamide,N-(5-chloro-2,4-dimethoxyphenyl)-4-((5-((diethylamino)sulfonyl)-2--methoxyphenyl)azo)-3-hydroxy |
| Pigment red 5 |
| C.I. Pigment Red 5 |