Introduction：Basic information about CAS 6358-09-4|2-Amino-6-chloro-4-nitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Amino-6-chloro-4-nitrophenol |
|---|
| CAS Number | 6358-09-4 | Molecular Weight | 188.56800 |
|---|
| Density | 1.655 g/cm3 | Boiling Point | 358.7ºC at 760 mmHg |
|---|
| Molecular Formula | C6H5ClN2O3 | Melting Point | 158-162.5℃ |
|---|
| MSDS | / | Flash Point | 170.8ºC |
|---|
Names
| Name | 2-Amino-6-chloro-4-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.655 g/cm3 |
|---|
| Boiling Point | 358.7ºC at 760 mmHg |
|---|
| Melting Point | 158-162.5℃ |
|---|
| Molecular Formula | C6H5ClN2O3 |
|---|
| Molecular Weight | 188.56800 |
|---|
| Flash Point | 170.8ºC |
|---|
| Exact Mass | 187.99900 |
|---|
| PSA | 92.07000 |
|---|
| LogP | 2.64040 |
|---|
| InChIKey | TWLMSPNQBKSXOP-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc([N+](=O)[O-])cc(Cl)c1O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2922299090 |
|---|
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-amino-4-nitro-6-chlorophenol |
| MFCD00035767 |
| Phenol,2-amino-6-chloro-4-nitro |
| 2-amino-6-chloro-4-nitro-phenol |
| EINECS 228-762-1 |
| 1-hydroxy-2-chloro-6-amino-4-nitrobenzene |
| 6-Chloro-4-nitro-2-aminophenol |
| 2-chloro-4-nitro-6-aminophenol |
| 2-Amino-6-chlor-4-nitro-phenol |
| 5-amino-3-chloro-4-hydroxynitrobenzene |
