Introduction:Basic information about CAS 6424-77-7|Pigment Red 190, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pigment Red 190 |
|---|
| CAS Number | 6424-77-7 | Molecular Weight | 602.59100 |
|---|
| Density | 1.511 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C38H22N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,9-Bis(p-anisyl)anthra(2,1,9-def:6,5,10-d'e'f')diisoquinoline-1,3,8,10(2H,9H)-tetrone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.511 g/cm3 |
|---|
| Molecular Formula | C38H22N2O6 |
|---|
| Molecular Weight | 602.59100 |
|---|
| Exact Mass | 602.14800 |
|---|
| PSA | 96.60000 |
|---|
| LogP | 5.95860 |
|---|
| Index of Refraction | 1.831 |
|---|
| InChIKey | VZFVREBNFMQPSI-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(N2C(=O)c3ccc4c5ccc6c7c(ccc(c8ccc(c3c48)C2=O)c75)C(=O)N(c2ccc(OC)cc2)C6=O)cc1 |
|---|
Synonyms
| 2,9-Bis-(4-methoxy-phenyl)-anthra[2,1,9-def,6,5,10-d'e'f']diisochinolin-1,3,8,10-tetraon |
| perylene-red |
| 2,9-bis(4-methoxyphenyl)isoquino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone |
| N,N'-Bis-(4-methoxyphenyl)-3,4,9,10-perylentetracarbonsaeure-diimid |
| C.I. Pigment Red 190 |
| EINECS 229-187-9 |
| 2,9-bis-(4-methoxy-phenyl)-anthra[2,1,9-def,6,5,10-d'e'f']diisoquinoline-1,3,8,10-tetraone |