Introduction：Basic information about CAS 98-25-9|2,6-Diaminotoluene-4-sulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Diaminotoluene-4-sulfonic acid |
|---|
| CAS Number | 98-25-9 | Molecular Weight | 202.23100 |
|---|
| Density | 2.070 | Boiling Point | / |
|---|
| Molecular Formula | C7H10N2O3S | Melting Point | 162ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3,5-diamino-4-methylbenzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.070 |
|---|
| Melting Point | 162ºC |
|---|
| Molecular Formula | C7H10N2O3S |
|---|
| Molecular Weight | 202.23100 |
|---|
| Exact Mass | 202.04100 |
|---|
| PSA | 114.79000 |
|---|
| LogP | 2.64930 |
|---|
| Index of Refraction | 1.657 |
|---|
| InChIKey | IPQWXJDRMKGSFI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(N)cc(S(=O)(=O)O)cc1N |
|---|
Safety Information
| Hazard Codes | Xn,N |
|---|
| Risk Phrases | R22:Harmful if swallowed. R40:Limited evidence of a carcinogenic effect. R42/43:May cause sensitization by inhalation and skin contact . R50/53:Very Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment . |
|---|
| Safety Phrases | S22-S36/37-S60-S61 |
|---|
| RIDADR | UN3288 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
Synonyms
| 2,5-BIS(1-METHYLETHYL)PIPERAZINE |
| 2-methyl-5-sulpho-1,3-phenylenediamine |
| 1,5-diamino-6-methylbenzene-3-sulfonic acid |
| 2,6-diamino-toluene-4-sulfonic acid |
| EINECS 202-649-7 |
| 2,6-Diamino-toluol-4-sulfonsaeure |
| 2,6-diamino-toluene-4-sulphonic acid |
| MFCD00035929 |
| 3,5-Diamino-p-toluenesulfonic acid |
| 1-methyl-2,6-diaminobenzene-4-sulphonic acid |
