Introduction：Basic information about CAS 582-73-0|4,4,4-Trifluoro-1-pyridin-3-yl-butane-1,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4,4-Trifluoro-1-pyridin-3-yl-butane-1,3-dione |
|---|
| CAS Number | 582-73-0 | Molecular Weight | 217.14500 |
|---|
| Density | 1.351g/cm3 | Boiling Point | 276ºC at 760mmHg |
|---|
| Molecular Formula | C9H6F3NO2 | Melting Point | 173-174ºC |
|---|
| MSDS | / | Flash Point | 120.7ºC |
|---|
Names
| Name | 4,4,4-trifluoro-1-pyridin-3-ylbutane-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.351g/cm3 |
|---|
| Boiling Point | 276ºC at 760mmHg |
|---|
| Melting Point | 173-174ºC |
|---|
| Molecular Formula | C9H6F3NO2 |
|---|
| Molecular Weight | 217.14500 |
|---|
| Flash Point | 120.7ºC |
|---|
| Exact Mass | 217.03500 |
|---|
| PSA | 47.03000 |
|---|
| LogP | 1.78580 |
|---|
| Index of Refraction | 1.501 |
|---|
| InChIKey | MXVYPMBHALRMDU-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CC(=O)C(F)(F)F)c1cccnc1 |
|---|
| Storage condition | Store at room temperature |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4,4,4-Trifluoro-1-(pyridin-3-yl)-1,3-butanedione |
| 4,4,4-trifluoro-1-(3-pyridyl)-1,3-butanedione |
| 4,4,4-Trifluor-1-(3-pyridyl)-1,3-butandion |
| 4,4,4-TRIFLUORO-1-(PYRIDINE-3-YL)BUTANE-1,3-DIONE |
| 4,4,4-trifluoro-1-[3]pyridyl-butane-1,3-dione |
| 4-(3'-Pyridyl)-1,1,1-trifluor-2,4-butandion |
| 4,4,4-Trifluoro-1-(pyridine-3-yl)-1,3-butanedione |
| 4,4,4-Trifluor-1-[3]pyridyl-butan-1,3-dion |
| 4,4,4-trifluoro-1-pyridin-3-yl-butane-1,3-dione |
| 1-(3-Pyridyl)-4,4,4-trifluoro-1,3-butanedione |
