Introduction：Basic information about CAS 65685-01-0|Biphenyl-3-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Biphenyl-3-sulfonyl chloride |
|---|
| CAS Number | 65685-01-0 | Molecular Weight | 252.71700 |
|---|
| Density | 1.321g/cm3 | Boiling Point | 397.824ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9ClO2S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 194.397ºC |
|---|
Names
| Name | 3-phenylbenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.321g/cm3 |
|---|
| Boiling Point | 397.824ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9ClO2S |
|---|
| Molecular Weight | 252.71700 |
|---|
| Flash Point | 194.397ºC |
|---|
| Exact Mass | 252.00100 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 4.36190 |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | LKSVJXWZVULUDA-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1cccc(-c2ccccc2)c1 |
|---|
Safety Information
| Hazard Codes | C,Xi |
|---|
| Risk Phrases | 36 |
|---|
| Safety Phrases | 26 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Biphenyl-3-sulfonyl chloride |
| 3-phenylbenzenesulphonyl chloride |
| biphenyl-3-sufonyl chloride |
| 3-phenylbenzenesulfonylchloride |
| Biphenyl-3-sulphonyl chloride |
| 3-biphenyl-sulfonyl chloride |
| 3-phenylbenzene-1-sulfonyl chloride |
| Biphenyl-3-sulfonylchlorid |
| 3-biphenyl chloride |
