Introduction:Basic information about CAS 1841-57-2|3'-Fluoro-4-biphenylcarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3'-Fluoro-4-biphenylcarboxylic acid |
|---|
| CAS Number | 1841-57-2 | Molecular Weight | 216.208 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 340.9±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H9FO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 160.0±20.9 °C |
|---|
Names
| Name | 2-(4-fluorophenyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 340.9±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H9FO2 |
|---|
| Molecular Weight | 216.208 |
|---|
| Flash Point | 160.0±20.9 °C |
|---|
| Exact Mass | 216.058655 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 2.93 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | LGVNEKHPDXUTKA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccccc1-c1ccc(F)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| MFCD03002065 |
| 3'-Fluorobiphenyl-4-carboxylic acid |
| 4'-Fluoro-2-biphenylcarboxylic acid |
| 4'-Fluor-2-biphenylcarbonsaeure |
| 4'-fluoro-1,1'-biphenyl-2-carboxylic acid |
| 4'-fluorobiphenyl-2-carboxylic acid |
| 2-Biphenyl-4'-fluoro-carboxylic acid |
| [1,1'-Biphenyl]-4-carboxylic acid, 3'-fluoro- |
| [1,1'-Biphenyl]-2-carboxylic acid, 4'-fluoro- |
| 4'-Fluoro-Biphenyl-2-Carboxylic Acid |
| 3'-Fluoro-4-biphenylcarboxylic acid |