Introduction：Basic information about CAS 332062-10-9|Fmoc-(R)-3-Amino-4,4-diphenyl-butyric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-(R)-3-Amino-4,4-diphenyl-butyric acid |
|---|
| CAS Number | 332062-10-9 | Molecular Weight | 477.550 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 691.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C31H27NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 371.9±31.5 °C |
|---|
Names
| Name | fmoc-(r)-3-amino-4,4-diphenyl-butyric acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 691.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C31H27NO4 |
|---|
| Molecular Weight | 477.550 |
|---|
| Flash Point | 371.9±31.5 °C |
|---|
| Exact Mass | 477.194000 |
|---|
| PSA | 89.62000 |
|---|
| LogP | 7.49 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | GQRZIYGFRVKFSB-MUUNZHRXSA-N |
|---|
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(c1ccccc1)c1ccccc1 |
|---|
Synonyms
| fmoc-(r)-3-amino-4,4-diphenylbutanoic acid |
| rarechem ak pt f001 |
| (3R)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4,4-diphenylbutanoic acid |
| fmoc-d-dph-(c*ch2)oh |
| Benzenebutanoic acid, β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-γ-phenyl-, (βR)- |
| n-(9-fluorenylmethoxycarbonyl)-(r)-3-amino-4,4-diphenyl-butanoic acid |
| fmoc-(r)-3-amino-4,4-diphenyl-butyricacid |
