Introduction:Basic information about CAS 32988-39-9|3-NITRO-DL-TYROSINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-NITRO-DL-TYROSINE |
|---|
| CAS Number | 32988-39-9 | Molecular Weight | 226.186 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 431.6±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H10N2O5 | Melting Point | >210 °C (dec.) |
|---|
| MSDS | / | Flash Point | 214.8±28.7 °C |
|---|
Names
| Name | (2R)-2-amino-3-(4-hydroxy-3-nitrophenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 431.6±45.0 °C at 760 mmHg |
|---|
| Melting Point | >210 °C (dec.) |
|---|
| Molecular Formula | C9H10N2O5 |
|---|
| Molecular Weight | 226.186 |
|---|
| Flash Point | 214.8±28.7 °C |
|---|
| Exact Mass | 226.058975 |
|---|
| PSA | 129.37000 |
|---|
| LogP | 0.60 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.651 |
|---|
| InChIKey | FBTSQILOGYXGMD-ZCFIWIBFSA-N |
|---|
| SMILES | NC(Cc1ccc(O)c([N+](=O)[O-])c1)C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2922509090 |
|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| m-Nitrotyrosine |
| 3-Nitro-D-tyrosine |
| 3-Mononitrotyrosine |
| Tyrosine, 3-nitro- |
| 2-ammonio-3-(4-hydroxy-3-nitrophenyl)propanoate |
| BB_NC-0471 |
| 3-Nitrotyrosine |
| (R)-2-amino-3-(4-hydroxy-3-nitrophenyl)propanoic acid |
| (R)-2-Amino-3-(4-hydroxy-3-nitro-phenyl)-propionic acid |
| 3-nitro-L-tyrosynie |
| D-Tyrosine,3-nitro |
| D-Tyrosine, 3-nitro- |