Introduction:Basic information about CAS 62965-37-1|Z-Tle-OH·DCHA, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Tle-OH·DCHA |
|---|
| CAS Number | 62965-37-1 | Molecular Weight | 446.62300 |
|---|
| Density | / | Boiling Point | 607.9ºC at 760 mmHg |
|---|
| Molecular Formula | C26H42N2O4 | Melting Point | 163-167ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 321.4ºC |
|---|
Names
| Name | N-cyclohexylcyclohexanamine,(2S)-3,3-dimethyl-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 607.9ºC at 760 mmHg |
|---|
| Melting Point | 163-167ºC |
|---|
| Molecular Formula | C26H42N2O4 |
|---|
| Molecular Weight | 446.62300 |
|---|
| Flash Point | 321.4ºC |
|---|
| Exact Mass | 446.31400 |
|---|
| PSA | 87.66000 |
|---|
| LogP | 6.43530 |
|---|
| InChIKey | ZZVHEFCADXTNTP-RFVHGSKJSA-N |
|---|
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)C(NC(=O)OCc1ccccc1)C(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Safety Phrases | 22-24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (S)-2-(((benzyloxy)carbonyl)amino)-3,3-dimethylbutanoic acid dicyclohexylammonium salt |
| Z-Tle-OH (dicyclohexylammonium) salt |
| Cbz-tert-leucine dicyclohexylammonium salt |
| Z-L-tert-Leucine (dicyclohexylammonium) salt |
| benzyloxycarbonyl-t-leucine dicyclohexylamine salt |
| MFCD00161480 |
| N-carboxybenzyl-L-tert-leucine dicyclohexylammonium salt |
| Z-Tle-OH dicyclohexylamine salt |
| (S)-2-Benzyloxycarbonylamino-3,3-dimethyl-buttersaeure,Dicyclohexylamin-Salz |
| Dicyclohexylamine (S)-2-(((benzyloxy)carbonyl)amino)-3,3-dimethylbutanoate |
| Cbz-L-tert-leucine dicyclohexylamine salt |
| (S)-2-benzyloxycarbonylamino-3,3-dimethyl-butyric acid,dicyclohexylamine salt |
| Z-Tle-OH.DCHA |
| Z-Tle-OH·DCHA |