Introduction：Basic information about CAS 7121-10-0|naphthol as-lc acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | naphthol as-lc acetate |
|---|
| CAS Number | 7121-10-0 | Molecular Weight | 399.82400 |
|---|
| Density | 1.332 g/cm3 | Boiling Point | 508.3ºC at 760 mmHg |
|---|
| Molecular Formula | C21H18ClNO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 261.2ºC |
|---|
Names
| Name | naphthol as-lc acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.332 g/cm3 |
|---|
| Boiling Point | 508.3ºC at 760 mmHg |
|---|
| Molecular Formula | C21H18ClNO5 |
|---|
| Molecular Weight | 399.82400 |
|---|
| Flash Point | 261.2ºC |
|---|
| Exact Mass | 399.08700 |
|---|
| PSA | 73.86000 |
|---|
| LogP | 4.76100 |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | JICRDMOKQCCJEN-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(NC(=O)c2cc3ccccc3cc2OC(C)=O)c(OC)cc1Cl |
|---|
Synonyms
| [3-[(4-chloro-2,5-dimethoxy-phenyl)carbamoyl]naphthalen-2-yl] ethanoate |
| 3-Acetyloxy-N-(4-chloro-2,5-dimethoxyphenyl)-2-naphthalenecarboxamide |
| acetic acid [3-[(4-chloro-2,5-dimethoxy-phenyl)carbamoyl]-2-naphthyl] ester |
| 2-[N-(4-chloro-2,5-dimethoxyphenyl)carbamoyl]-3-naphthyl acetate |
| [3-[(4-chloro-2,5-dimethoxyphenyl)carbamoyl]naphthalen-2-yl] acetate |
