Introduction:Basic information about CAS 49561-88-8|(3-tert-butylphenyl) carbonochloridate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3-tert-butylphenyl) carbonochloridate |
|---|
| CAS Number | 49561-88-8 | Molecular Weight | 212.67300 |
|---|
| Density | 1.127g/cm3 | Boiling Point | 250.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13ClO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 90.8ºC |
|---|
Names
| Name | (3-tert-butylphenyl) carbonochloridate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.127g/cm3 |
|---|
| Boiling Point | 250.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13ClO2 |
|---|
| Molecular Weight | 212.67300 |
|---|
| Flash Point | 90.8ºC |
|---|
| Exact Mass | 212.06000 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.72170 |
|---|
| Index of Refraction | 1.507 |
|---|
| InChIKey | BYUPCPGESMKIBW-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cccc(OC(=O)Cl)c1 |
|---|
Synonyms
| EINECS 256-374-2 |
| (3-tert-butylphenyl) chloroformate |
| m-tert-Butylphenyl chloroformate |