Introduction：Basic information about CAS 3457-61-2|Peroxide,1,1-dimethylethyl 1-methyl-1-phenylethyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Peroxide,1,1-dimethylethyl 1-methyl-1-phenylethyl |
|---|
| CAS Number | 3457-61-2 | Molecular Weight | 208.29700 |
|---|
| Density | 0.93 g/cm 3 | Boiling Point | 249.4ºC |
|---|
| Molecular Formula | C13H20O2 | Melting Point | 6ºC |
|---|
| MSDS | / | Flash Point | 75ºC |
|---|
Names
| Name | tert-butyl cumyl peroxide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.93 g/cm 3 |
|---|
| Boiling Point | 249.4ºC |
|---|
| Melting Point | 6ºC |
|---|
| Molecular Formula | C13H20O2 |
|---|
| Molecular Weight | 208.29700 |
|---|
| Flash Point | 75ºC |
|---|
| Exact Mass | 208.14600 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 3.66840 |
|---|
| Index of Refraction | 1.419-1.423 |
|---|
| InChIKey | BIISIZOQPWZPPS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OOC(C)(C)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | O;Xi;N |
|---|
| Risk Phrases | R7 |
|---|
| Safety Phrases | 61-36/37/39-3/7-14A-14 |
|---|
| RIDADR | UN3105 5.2/PG 2 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 5.2 |
|---|
| HS Code | 2909600000 |
|---|
Customs
| HS Code | 2909600000 |
|---|
| Summary | 2909600000 alcohol peroxides, ether peroxides, ketone peroxides and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| tert-butylcumeneperoxide |
| tert.-Butylcumylperoxid |
| Luperco 801-XL |
| Trigonox T |
| t-Butyl cumyl peroxide |
| MFCD00128882 |
| NA-2091 |
| tert-Butyl-(1-methyl-1-phenyl-aethyl)-peroxid |
| EINECS 222-389-8 |
| tert-butyl-(1-methyl-1-phenyl-ethyl)-peroxide |
| Butyl cumyl peroxide |
| Cumyl tert-butyl peroxide |
| Kayabutyl C |
| tert-butyl peroxide |
| 2-(t-butylperoxy)-2-phenylpropane |
