Introduction：Basic information about CAS 929095-57-8|2-bromo-4-(dimethoxymethyl)-1-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-bromo-4-(dimethoxymethyl)-1-nitrobenzene |
|---|
| CAS Number | 929095-57-8 | Molecular Weight | 276.08400 |
|---|
| Density | 1.531g/cm3 | Boiling Point | 292.6ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10BrNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 130.8ºC |
|---|
Names
| Name | 2-bromo-4-(dimethoxymethyl)-1-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.531g/cm3 |
|---|
| Boiling Point | 292.6ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10BrNO4 |
|---|
| Molecular Weight | 276.08400 |
|---|
| Flash Point | 130.8ºC |
|---|
| Exact Mass | 274.97900 |
|---|
| PSA | 64.28000 |
|---|
| LogP | 3.17190 |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | YVZGRDVURZBPIB-UHFFFAOYSA-N |
|---|
| SMILES | COC(OC)c1ccc([N+](=O)[O-])c(Br)c1 |
|---|
Synonyms
| 2-bromo-4-dimethoxymethyl-1-nitro-benzene |
| 2-Bromo-4-dimethoxymethylnitrobenzene |
| 4-[bis(methyloxy)methyl]-2-bromo-1-nitrobenzene |
