Introduction：Basic information about CAS 1016-05-3|dibenzothiophene-5,5-dioxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dibenzothiophene-5,5-dioxide |
|---|
| CAS Number | 1016-05-3 | Molecular Weight | 216.256 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 422.2±12.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H8O2S | Melting Point | 231-233 °C(lit.) |
|---|
| MSDS | / | Flash Point | 275.7±12.2 °C |
|---|
Names
| Name | Dibenzothiophene 5,5-Dioxide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 422.2±12.0 °C at 760 mmHg |
|---|
| Melting Point | 231-233 °C(lit.) |
|---|
| Molecular Formula | C12H8O2S |
|---|
| Molecular Weight | 216.256 |
|---|
| Flash Point | 275.7±12.2 °C |
|---|
| Exact Mass | 216.024506 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 2.74 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.675 |
|---|
| InChIKey | IKJFYINYNJYDTA-UHFFFAOYSA-N |
|---|
| SMILES | O=S1(=O)c2ccccc2-c2ccccc21 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S24/25 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Dibenzo[b,d]thiophene 5,5-dioxide |
| Dibenzothiophene Sulfone |
| Dibenzosulfolane |
| dibenzothiophene-S,S-dioxide |
| dibenzothiophene-5,5-dioxide |
| EINECS 213-805-9 |
| Dibenzo[b,d]thiophene, 5,5-dioxide |
| dibenzothiophene 5,5-dioxide |
| MFCD00004970 |
