Introduction：Basic information about CAS 928713-84-2|2-(4-chlorophenyl)pyrimidine-5-carbaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-chlorophenyl)pyrimidine-5-carbaldehyde |
|---|
| CAS Number | 928713-84-2 | Molecular Weight | 218.63900 |
|---|
| Density | 1.327g/cm3 | Boiling Point | 272.562ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7ClN2O | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 118.642ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-(4-chlorophenyl)pyrimidine-5-carbaldehyde |
|---|
Chemical & Physical Properties
| Density | 1.327g/cm3 |
|---|
| Boiling Point | 272.562ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7ClN2O |
|---|
| Molecular Weight | 218.63900 |
|---|
| Flash Point | 118.642ºC |
|---|
| Exact Mass | 218.02500 |
|---|
| PSA | 42.85000 |
|---|
| LogP | 2.60950 |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | BUGWBANLAMFQAX-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1cnc(-c2ccc(Cl)cc2)nc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
