Introduction：Basic information about CAS 97571-69-2|Icosafluoro-15-crown 5-Ether, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Icosafluoro-15-crown 5-Ether |
|---|
| CAS Number | 97571-69-2 | Molecular Weight | 580.07200 |
|---|
| Density | >1.300 | Boiling Point | 145ºC |
|---|
| Molecular Formula | C10F20O5 | Melting Point | -12°C(lit.) |
|---|
| MSDS | / | Flash Point | 45.9ºC |
|---|
Names
| Name | 2,2,3,3,5,5,6,6,8,8,9,9,11,11,12,12,14,14,15,15-icosafluoro-1,4,7,10,13-pentaoxacyclopentadecane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | >1.300 |
|---|
| Boiling Point | 145ºC |
|---|
| Melting Point | -12°C(lit.) |
|---|
| Molecular Formula | C10F20O5 |
|---|
| Molecular Weight | 580.07200 |
|---|
| Flash Point | 45.9ºC |
|---|
| Exact Mass | 579.94300 |
|---|
| PSA | 46.15000 |
|---|
| LogP | 6.01100 |
|---|
| Index of Refraction | 1.296 |
|---|
| InChIKey | CAKZCCWLOCDNJK-UHFFFAOYSA-N |
|---|
| SMILES | FC1(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC1(F)F |
|---|
Safety Information
| Hazard Codes | Xi,C,F |
|---|
| Risk Phrases | R11 |
|---|
| Safety Phrases | S23-S24/25 |
|---|
Synonyms
| eicosafluoro-15-crown-5 ether |
| perfluoro-15-crown |
| Perfluoro 15-crown-5 |
| icosafluoro-15-crown-5 |
| perfluor-15-crown-5 |
| Perfluoro 15-crown-5 ether |
