Introduction:Basic information about CAS 58457-98-0|(S)-Methyl 2-N-Cbz-3-n-Boc-propanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-Methyl 2-N-Cbz-3-n-Boc-propanoate |
|---|
| CAS Number | 58457-98-0 | Molecular Weight | 352.38200 |
|---|
| Density | 1.177 | Boiling Point | 514.325ºC at 760 mmHg |
|---|
| Molecular Formula | C17H24N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | methyl (2S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)propanoate |
|---|
Chemical & Physical Properties
| Density | 1.177 |
|---|
| Boiling Point | 514.325ºC at 760 mmHg |
|---|
| Molecular Formula | C17H24N2O6 |
|---|
| Molecular Weight | 352.38200 |
|---|
| Exact Mass | 352.16300 |
|---|
| PSA | 102.96000 |
|---|
| LogP | 2.76090 |
|---|
| Index of Refraction | 1.513 |
|---|
| InChIKey | MDMZRMHNXPKKND-ZDUSSCGKSA-N |
|---|
| SMILES | COC(=O)C(CNC(=O)OC(C)(C)C)NC(=O)OCc1ccccc1 |
|---|