Introduction：Basic information about CAS 588702-66-3|3-(Trifluoromethyl)-8-quinolinecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(Trifluoromethyl)-8-quinolinecarboxylic acid |
|---|
| CAS Number | 588702-66-3 | Molecular Weight | 241.166 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 379.6±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H6F3NO2 | Melting Point | 182-185℃(decomp)(Solv: ethanol (64-17-5)) |
|---|
| MSDS | / | Flash Point | 183.4±26.5 °C |
|---|
Names
| Name | 3-(Trifluoromethyl)quinoline-8-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 379.6±37.0 °C at 760 mmHg |
|---|
| Melting Point | 182-185℃(decomp)(Solv: ethanol (64-17-5)) |
|---|
| Molecular Formula | C11H6F3NO2 |
|---|
| Molecular Weight | 241.166 |
|---|
| Flash Point | 183.4±26.5 °C |
|---|
| Exact Mass | 241.035065 |
|---|
| PSA | 50.19000 |
|---|
| LogP | 1.97 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | ZBVKRLUVHQGYGA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc2cc(C(F)(F)F)cnc12 |
|---|
Synonyms
| pc9235 |
| 3-(Trifluoromethyl)quinoline-8-carboxylic acid |
| 3-(Trifluoromethyl)-8-quinolinecarboxylic acid |
| 8-Quinolinecarboxylic acid, 3-(trifluoromethyl)- |
