Introduction：Basic information about CAS 1877-64-1|3-Methanesulfonylphenylacetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Methanesulfonylphenylacetic acid |
|---|
| CAS Number | 1877-64-1 | Molecular Weight | 214.238 |
|---|
| Density | 1.350±0.06 g/cm3 | Boiling Point | 459.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H10O4S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 231.5±26.5 °C |
|---|
Names
| Name | 2-(3-methylsulfonylphenyl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.350±0.06 g/cm3 |
|---|
| Boiling Point | 459.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H10O4S |
|---|
| Molecular Weight | 214.238 |
|---|
| Flash Point | 231.5±26.5 °C |
|---|
| Exact Mass | 214.029984 |
|---|
| PSA | 79.82000 |
|---|
| LogP | -0.21 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.557 |
|---|
| InChIKey | RUGDYDBEYAHJCD-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1cccc(CC(=O)O)c1 |
|---|
| Water Solubility | Slightly soluble (6 g/L) (25 ºC) |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| [3-(Methylsulfonyl)phenyl]acetic acid |
| Benzeneacetic acid, 3-(methylsulfonyl)- |
| 3-methylsulfonylphenylacetic acid |
| 3-Methylsulfonyl-phenylessigsaeure |
| 2-[3-(methylsulfonyl)phenyl]acetic acid |
| 2-(3-(Methylsulfonyl)phenyl)acetic acid |
| 3-Methanesulfonylphenylacetic acid |
| 2-(3-methanesulfonylphenyl)acetic acid |
