Introduction:Basic information about CAS 3365-85-3|4,4''-DIAMINO-P-TERPHENYL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4''-DIAMINO-P-TERPHENYL |
|---|
| CAS Number | 3365-85-3 | Molecular Weight | 260.33300 |
|---|
| Density | 1.159g/cm3 | Boiling Point | 484.2ºC at 760 mmHg |
|---|
| Molecular Formula | C18H16N2 | Melting Point | 242-244ºC |
|---|
| MSDS | / | Flash Point | 296.3ºC |
|---|
Names
| Name | 4-[4-(4-aminophenyl)phenyl]aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.159g/cm3 |
|---|
| Boiling Point | 484.2ºC at 760 mmHg |
|---|
| Melting Point | 242-244ºC |
|---|
| Molecular Formula | C18H16N2 |
|---|
| Molecular Weight | 260.33300 |
|---|
| Flash Point | 296.3ºC |
|---|
| Exact Mass | 260.13100 |
|---|
| PSA | 52.04000 |
|---|
| LogP | 5.34740 |
|---|
| Index of Refraction | 1.67 |
|---|
| InChIKey | QBSMHWVGUPQNJJ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(-c2ccc(-c3ccc(N)cc3)cc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R20/21/22;R45 |
|---|
| Safety Phrases | S45-S53 |
|---|
| RIDADR | UN 2811 |
|---|
| HS Code | 2921590090 |
|---|
Customs
| HS Code | 2921590090 |
|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4,4''-Diaminoterphenyl |
| 4,4'-p-terphenylenediamine |
| 1,1':4',1''-terphenyl-4,4''-diamine |
| p-Terphenyl,4,4''-diamine |
| 4,4''-Diamino-p-terphenyl |
| MFCD00051532 |
| 4,4''-diamino-[1,1',4',1'']terphenyl |
| [1,1':4',1''-terphenyl]-3,3'',5,5''-tetraamine |
| terphenyl-4,4''-diamine |