Introduction：Basic information about CAS 17350-17-3|Z-Pro-Phe-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Pro-Phe-OH |
|---|
| CAS Number | 17350-17-3 | Molecular Weight | 396.43600 |
|---|
| Density | 1.291 g/cm3 | Boiling Point | 653.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H24N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 349.1ºC |
|---|
Names
| Name | 3-phenyl-2-[(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)amino]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.291 g/cm3 |
|---|
| Boiling Point | 653.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H24N2O5 |
|---|
| Molecular Weight | 396.43600 |
|---|
| Flash Point | 349.1ºC |
|---|
| Exact Mass | 396.16900 |
|---|
| PSA | 95.94000 |
|---|
| LogP | 2.92850 |
|---|
| Vapour Pressure | 5.68E-18mmHg at 25°C |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | GMUYSWQSSRROPG-OALUTQOASA-N |
|---|
| SMILES | O=C(O)C(Cc1ccccc1)NC(=O)C1CCCN1C(=O)OCc1ccccc1 |
|---|
Synonyms
| Z-Pro-Phe |
| N-Cbz-L-Pro-L-Phe |
| N-Cbz-Pro-Phe |
| Cbz-L-Pro-L-Phe |
| Cbz-L-Pro-L-Phe-OH |
| Z-Pro-Phe-OH |
