Introduction：Basic information about CAS 987-84-8|Z-Glu-Phe-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Glu-Phe-OH |
|---|
| CAS Number | 987-84-8 | Molecular Weight | 428.43500 |
|---|
| Density | 1.325 g/cm3 | Boiling Point | 760.4ºC at 760 mmHg |
|---|
| Molecular Formula | C22H24N2O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 413.7ºC |
|---|
Names
| Name | 5-[(1-carboxy-2-phenylethyl)amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.325 g/cm3 |
|---|
| Boiling Point | 760.4ºC at 760 mmHg |
|---|
| Molecular Formula | C22H24N2O7 |
|---|
| Molecular Weight | 428.43500 |
|---|
| Flash Point | 413.7ºC |
|---|
| Exact Mass | 428.15800 |
|---|
| PSA | 142.03000 |
|---|
| LogP | 2.74010 |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | ZORDBMVWKMEZAC-ROUUACIJSA-N |
|---|
| SMILES | O=C(O)CCC(NC(=O)OCc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)O |
|---|
Synonyms
| EINECS 213-581-2 |
| Cbz-L-Glu-L-Phe-OH |
| Z-Glu-Phe-OH |
