Introduction:Basic information about CAS 715-33-3|methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate |
|---|
| CAS Number | 715-33-3 | Molecular Weight | 339.96500 |
|---|
| Density | 1.967g/cm3 | Boiling Point | 307.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H8Br2O4 | Melting Point | 109-111ºC |
|---|
| MSDS | / | Flash Point | 139.7ºC |
|---|
Names
| Name | methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.967g/cm3 |
|---|
| Boiling Point | 307.4ºC at 760 mmHg |
|---|
| Melting Point | 109-111ºC |
|---|
| Molecular Formula | C9H8Br2O4 |
|---|
| Molecular Weight | 339.96500 |
|---|
| Flash Point | 139.7ºC |
|---|
| Exact Mass | 337.87900 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 2.71780 |
|---|
| Index of Refraction | 1.636 |
|---|
| InChIKey | OKALYLLBFOYLQB-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1c(C)c(Br)c(O)c(Br)c1O |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2918199090 |
|---|
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 3.5-Dibrom-orsellinsaeuremethylester |
| 3,5-dibromo-2,4-dihydroxy-6-methyl-benzoic acid methyl ester |
| eso-Dibrom-orsellinsaeure-methylester |
| 3.5-Dibrom-2.4-dihydroxy-6-methyl-benzoesaeure-methylester |
| MFCD00082715 |